37959-40-3 Usage
Heterocyclic compound
Pyrrole and imidazole rings This compound contains a pyrrole ring (a five-membered ring with one nitrogen atom) fused to an imidazole ring (a six-membered ring with two nitrogen atoms).
Benzyl and phenyl groups
Attached to different positions The molecule has a benzyl group (a phenyl group attached to a methylene group) and a phenyl group (a six-membered carbon ring with alternating single and double bonds) attached to different positions of the molecule.
Potential applications
Medicinal chemistry and drug development Due to its unique structure and potential biological activity, 1-Benzyl-6-phenyl-1H-pyrrolo(1,2-a)imidazole may have implications in the development of new pharmaceuticals or as a building block for synthesizing other organic compounds with similar structures and properties.
Research status
Not widely studied Further research is needed to fully understand the potential uses and properties of 1-Benzyl-6-phenyl-1H-pyrrolo(1,2-a)imidazole.
Check Digit Verification of cas no
The CAS Registry Mumber 37959-40-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,7,9,5 and 9 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 37959-40:
(7*3)+(6*7)+(5*9)+(4*5)+(3*9)+(2*4)+(1*0)=163
163 % 10 = 3
So 37959-40-3 is a valid CAS Registry Number.
InChI:InChI=1/C19H16N2/c1-3-7-16(8-4-1)14-20-11-12-21-15-18(13-19(20)21)17-9-5-2-6-10-17/h1-13,15H,14H2
