380499-66-1 Usage
General Description
4-[5-(4-Dimethylaminophenyl)oxazol-2-yl]benzeneboronic Acid 97 is a specific boronic acid compound which, like other boronic acids, is utilized largely in organic chemistry and material science due to its ability to form reversible covalent bonds with sugars, amino acids, and other biologically relevant substances. Notably, it carries an oxazole ring and dimethylaminophenyl side group contributing to its distinct chemical properties and potential applications. However, while the name suggests a purity of 97%, specific attributes such as its physical state, color, melting point, boiling point, and other chemical properties, as well as its specific applications, safety considerations, or potential hazards, are not indicated without further detail or context.
Check Digit Verification of cas no
The CAS Registry Mumber 380499-66-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,8,0,4,9 and 9 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 380499-66:
(8*3)+(7*8)+(6*0)+(5*4)+(4*9)+(3*9)+(2*6)+(1*6)=181
181 % 10 = 1
So 380499-66-1 is a valid CAS Registry Number.
InChI:InChI=1/C17H17BN2O3/c1-20(2)15-9-5-12(6-10-15)16-11-19-17(23-16)13-3-7-14(8-4-13)18(21)22/h3-11,21-22H,1-2H3
380499-66-1Relevant articles and documents
A new highly fluorescent probe for monosaccharides based on a donor-acceptor diphenyloxazole
DiCesare,Lakowicz
, p. 2022 - 2023 (2001)
A diphenyloxazole substituted with a dimethylamino and a boronic acid group showing intramolecular charge transfer in the excited state undergoes large spectral changes in the presence of monosaccharides.