380603-10-1 Usage
Chemical class
Belongs to the class of organic compounds known as benzimidazoles.
Heterocyclic compound
Contains a cyclopropyl group, an imidazole ring, and a benzoimidazole moiety.
Derivative
A derivative of imidazopyridine.
Pharmaceutical applications
Has potential pharmaceutical applications due to its ability to interact with biological targets.
Hydroxybutyl group
Presence of the hydroxybutyl group makes it a promising candidate for drug development.
Modulation of biological activity
The hydroxybutyl group can potentially modulate the compound's biological activity.
Use in medicinal chemistry
Has the potential for use in medicinal chemistry and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 380603-10-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,8,0,6,0 and 3 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 380603-10:
(8*3)+(7*8)+(6*0)+(5*6)+(4*0)+(3*3)+(2*1)+(1*0)=121
121 % 10 = 1
So 380603-10-1 is a valid CAS Registry Number.
InChI:InChI=1/C21H23N5O2/c27-12-4-3-11-24-17-6-2-1-5-16(17)23-20(24)14-25-19-13-22-10-9-18(19)26(21(25)28)15-7-8-15/h1-2,5-6,9-10,13,15,27H,3-4,7-8,11-12,14H2