38076-81-2 Usage
Uses
Used in Pharmaceutical Synthesis:
2-Hydroxy-4-methylpyridine-3-carboxylic acid is used as a key intermediate in the synthesis of various pharmaceuticals due to its unique chemical structure and functional groups. Its presence in the synthesis process can lead to the development of new drugs with improved therapeutic properties.
Used in Organic Compound Production:
As an intermediate, 2-Hydroxy-4-methylpyridine-3-carboxylic acid is utilized in the production of a range of organic compounds. Its versatility in chemical reactions allows for the creation of diverse molecules with potential applications in various industries.
Used in Pharmaceutical Industry for Biological Activity Research:
Given its potential biological activity, 2-Hydroxy-4-methylpyridine-3-carboxylic acid is used in the pharmaceutical industry for research into its possible effects on biological systems. This research could lead to the discovery of new therapeutic agents or mechanisms of action for existing drugs.
Used in Drug Development:
2-Hydroxy-4-methylpyridine-3-carboxylic acid is used as a starting material or building block in drug development. Its unique properties may contribute to the creation of novel drug candidates with specific therapeutic targets or improved pharmacokinetic profiles.
Check Digit Verification of cas no
The CAS Registry Mumber 38076-81-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,8,0,7 and 6 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 38076-81:
(7*3)+(6*8)+(5*0)+(4*7)+(3*6)+(2*8)+(1*1)=132
132 % 10 = 2
So 38076-81-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H7NO3/c1-4-2-3-8-6(9)5(4)7(10)11/h2-3H,1H3,(H,8,9)(H,10,11)
