38157-71-0 Usage
Uses
Used in Pharmaceutical Research and Drug Development:
(E)-3-CYANO-3-(METHYLIMINO)-2-OXOPROPANOIC ACID is utilized as a key intermediate in the synthesis of hydroxyproline, which is crucial for the formation of collagen. Its involvement in the production of GABA makes it a valuable compound for the development of drugs targeting the GABAergic system, which is implicated in various neurological and psychiatric disorders.
Used in Organic Synthesis:
In the field of organic synthesis, (E)-3-CYANO-3-(METHYLIMINO)-2-OXOPROPANOIC ACID is employed as a reagent or intermediate in chemical reactions, contributing to the creation of new compounds and materials with potential applications in various industries.
Used in Neurotransmitter Modulation:
(E)-3-CYANO-3-(METHYLIMINO)-2-OXOPROPANOIC ACID is used as a modulator of GABA receptors, which is significant for the development of therapeutic agents aimed at treating conditions related to the GABAergic system, such as anxiety, epilepsy, and other neurological disorders. Its ability to modulate these receptors can lead to the discovery of new treatments and interventions for these conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 38157-71-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,8,1,5 and 7 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 38157-71:
(7*3)+(6*8)+(5*1)+(4*5)+(3*7)+(2*7)+(1*1)=130
130 % 10 = 0
So 38157-71-0 is a valid CAS Registry Number.
InChI:InChI=1/C5H4N2O3/c1-7-3(2-6)4(8)5(9)10/h1H3,(H,9,10)/b7-3+
