38185-56-7 Usage
General Description
2-Fluoro-3-Chloro-5-Bromopyridine is a chemical compound with the molecular formula C5H2BrClFN. It is a derivative of pyridine, a heterocyclic compound often used in pharmaceuticals and agrochemicals. This specific compound is of interest for its potential use in the synthesis of organic compounds and pharmaceuticals. Its unique combination of fluorine, chlorine, and bromine atoms make it a valuable building block for creating more complex molecular structures. Additionally, the presence of these halogen atoms can also impart specific properties to the compound, such as increased stability or reactivity in certain chemical reactions. Further research and experimentation with 2-Fluoro-3-Chloro-5-Bromopyridine may reveal additional applications and uses for this chemical.
Check Digit Verification of cas no
The CAS Registry Mumber 38185-56-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,8,1,8 and 5 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 38185-56:
(7*3)+(6*8)+(5*1)+(4*8)+(3*5)+(2*5)+(1*6)=137
137 % 10 = 7
So 38185-56-7 is a valid CAS Registry Number.
InChI:InChI=1/C5H2BrClFN/c6-3-1-4(7)5(8)9-2-3/h1-2H
38185-56-7Relevant articles and documents
HETEROARYLOXY QUINAZOLINE DERIVATIVE
-
Page/Page column 46, (2010/09/05)
Disclosed are compounds of the following formula and their pharmaceutically-acceptable salts, which have an effect of glucokinase activation and are useful in the field of medicines for treatment for diabetes, obesity, etc. (wherein ring A represents a pyrazolyl group optionally having a lower alkyl group, etc.; ring B represents a heteroaryl group; R represents a lower alkyl group, etc.; R1 represents a group of a formula: (wherein R11 and R12 each independently represent a hydrogen atom, etc.; m indicates an integer of from 2 to 6), etc.; R2 represents a lower alkyl group, etc.; r indicates an integer of from 0 to 3; k indicates an integer of from 0 to 4).
