38214-46-9 Usage
Uses
Used in Chemical Research:
6-Amino-pyrimidine-4-carboxylic acid is used as a research compound for studying its potential biological activities and exploring its applications in various fields of chemistry.
Used in Pharmaceutical Industry:
6-Amino-pyrimidine-4-carboxylic acid is used as a building block or intermediate in the synthesis of various pharmaceutical compounds, including antiviral, anticancer, and antimicrobial agents, due to its unique chemical structure and potential biological properties.
Used in Biochemical Applications:
6-Amino-pyrimidine-4-carboxylic acid can be used as a component in the development of biochemical assays, probes, and inhibitors, taking advantage of its ability to interact with specific biological targets and enzymes.
Used in Material Science:
6-Amino-pyrimidine-4-carboxylic acid may be utilized in the development of novel materials with specific properties, such as sensors, catalysts, or functional coatings, due to its chemical reactivity and potential to form complexes with other molecules.
Used in Agricultural Chemistry:
6-Amino-pyrimidine-4-carboxylic acid can be employed as a component in the development of new agrochemicals, such as herbicides, pesticides, or plant growth regulators, leveraging its potential biological activities and interactions with plant systems.
Note: The specific applications mentioned above are hypothetical and based on the general properties of 6-Amino-pyrimidine-4-carboxylic acid. Further research and development would be required to validate these applications in practice.
Check Digit Verification of cas no
The CAS Registry Mumber 38214-46-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,8,2,1 and 4 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 38214-46:
(7*3)+(6*8)+(5*2)+(4*1)+(3*4)+(2*4)+(1*6)=109
109 % 10 = 9
So 38214-46-9 is a valid CAS Registry Number.
InChI:InChI=1/C5H5N3O2/c6-4-1-3(5(9)10)7-2-8-4/h1-2H,(H,9,10)(H2,6,7,8)
