38222-35-4 Usage
Uses
Used in Organic Synthesis:
3-(Dimethylamino)-2,5-dihydroxy-5-methyl-2-cyclopenten-1-one is used as a building block in organic synthesis for the creation of various complex organic molecules. Its unique structure and functional groups allow for specific reactivity and the formation of new chemical bonds.
Used in Medicinal Chemistry:
In the pharmaceutical industry, 3-(Dimethylamino)-2,5-dihydroxy-5-methyl-2-cyclopenten-1-one is used as a key intermediate in the development of new drugs. The presence of the dimethylamino group can contribute to the compound's biological activity, making it a promising candidate for medicinal applications.
Used in Materials Science:
3-(Dimethylamino)-2,5-dihydroxy-5-methyl-2-cyclopenten-1-one is utilized in materials science for the development of new materials with specific properties. 3-(Dimethylamino)-2,5-dihydroxy-5-methyl-2-cyclopenten-1-one's reactivity and the ability to form stable structures make it suitable for creating advanced materials with tailored characteristics for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 38222-35-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,8,2,2 and 2 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 38222-35:
(7*3)+(6*8)+(5*2)+(4*2)+(3*2)+(2*3)+(1*5)=104
104 % 10 = 4
So 38222-35-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H13NO3/c1-8(12)4-5(9(2)3)6(10)7(8)11/h10,12H,4H2,1-3H3
