38233-47-5 Usage
Description
2,3,4-Trifluoro-5-methoxybenzoic acid, with the CAS number 38233-47-5, is an organic compound characterized by the presence of three fluorine atoms at the 2nd, 3rd, and 4th positions, and a methoxy group at the 5th position of the benzoic acid structure. This unique arrangement of functional groups endows the molecule with specific chemical properties that make it valuable in various applications.
Uses
Used in Organic Synthesis:
2,3,4-Trifluoro-5-methoxybenzoic acid is used as a key intermediate in the synthesis of various organic compounds. Its unique structure allows for selective functionalization and modification, making it a versatile building block for the development of new molecules with potential applications in pharmaceuticals, agrochemicals, and other specialty chemicals.
The specific application reason for 2,3,4-Trifluoro-5-methoxybenzoic acid in organic synthesis is its ability to serve as a starting material for the creation of a wide range of fluorinated and methoxylated derivatives. These derivatives can exhibit diverse biological activities and properties, which can be exploited in the design of new drugs, agrochemicals, and other advanced materials.
Check Digit Verification of cas no
The CAS Registry Mumber 38233-47-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,8,2,3 and 3 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 38233-47:
(7*3)+(6*8)+(5*2)+(4*3)+(3*3)+(2*4)+(1*7)=115
115 % 10 = 5
So 38233-47-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H5F3O3/c1-14-4-2-3(8(12)13)5(9)7(11)6(4)10/h2H,1H3,(H,12,13)