3824-21-3 Usage
Uses
Used in Organic Chemistry Research:
Benzene, 2-fluoro-4-iodo-1-methoxyis utilized as a synthetic intermediate in organic chemistry for the preparation of various complex organic molecules. Its unique functional groups allow for further chemical reactions and modifications, making it a versatile building block for the synthesis of new compounds with potential applications in various industries.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, Benzene, 2-fluoro-4-iodo-1-methoxyis employed as a key intermediate in the synthesis of pharmaceutical compounds. Its distinct molecular structure can be incorporated into drug molecules to modulate their properties, such as solubility, stability, and biological activity. Benzene, 2-fluoro-4-iodo-1-Methoxymay contribute to the development of new drugs with improved therapeutic effects and reduced side effects.
Used in Material Science:
Benzene, 2-fluoro-4-iodo-1-methoxymay also find applications in material science, particularly in the development of novel materials with specific properties. Its unique structure can be used to create new polymers, coatings, or other materials with tailored characteristics for use in various applications, such as electronics, sensors, or environmental protection.
Check Digit Verification of cas no
The CAS Registry Mumber 3824-21-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,8,2 and 4 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 3824-21:
(6*3)+(5*8)+(4*2)+(3*4)+(2*2)+(1*1)=83
83 % 10 = 3
So 3824-21-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H6FIO/c1-10-7-3-2-5(9)4-6(7)8/h2-4H,1H3
3824-21-3Relevant articles and documents
New method of synthesis and biological evaluation of some combretastatin A-4 analogues
Malysheva, Yulia B.,Combes, Sebastien,Fedorov, Alexey Yu.,Knochel, Paul,Gavryushin, Andrei E.
supporting information; experimental part, p. 1205 - 1208 (2012/06/29)
A series of novel combretastatin A-4 analogues was synthesized in 36-64% yields by Negishi cross-coupling reaction under mild conditions. The prepared compounds exhibit good cytotoxicity against HBL100 epithelial cell lines (IC50=0.022-10.31 ). Georg Thieme Verlag Stuttgart · New York.
