38258-92-3 Usage
Bicyclic compound
It has a two-ring structure This refers to the fact that the compound has two cyclic structures (rings) within its molecular structure.
Nitrogen atom
Contains a nitrogen atom The compound includes a nitrogen atom in its structure, which is important for its chemical properties and reactivity.
Methoxy group
Contains a methoxy group A methoxy group (-OCH3) is a functional group consisting of an oxygen atom connected to a methyl group (-CH3), which is attached to the bicyclic structure of the compound.
Building block in organic synthesis
Commonly used as a building block This compound is frequently utilized as a starting material or intermediate in the synthesis of more complex organic molecules.
Pharmaceutical research
Used in pharmaceutical research 1-Methoxybicyclo[2.2.2]oct-5-ene-2-carbonitrile is valuable in the development of new drugs due to its unique structure and properties.
Unique structure
Has a unique structure The specific arrangement of atoms and functional groups in this compound makes it particularly useful in the development of various drugs and organic compounds.
Chemical properties
Has important chemical properties The properties of 1-Methoxybicyclo[2.2.2]oct-5-ene-2-carbonitrile make it a valuable intermediate in the synthesis of bioactive molecules.
Starting material
Used as a starting material for complex chemical compounds This compound serves as a foundation for creating other complex chemical compounds, making it a versatile and important substance in the field of chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 38258-92-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,8,2,5 and 8 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 38258-92:
(7*3)+(6*8)+(5*2)+(4*5)+(3*8)+(2*9)+(1*2)=143
143 % 10 = 3
So 38258-92-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H13NO/c1-12-10-4-2-8(3-5-10)6-9(10)7-11/h2,4,8-9H,3,5-6H2,1H3
Xn:Harmful;
