38665-30-4 Usage
General Description
(Z)-N-(1-Oxooctadec-9-en-1-yl)-DL-methionine is a chemical compound with the molecular formula C23H43NO4S. It is a derivative of the amino acid DL-methionine, which plays a key role in protein synthesis and is essential for various metabolic processes in the body. The compound contains a long chain of 18 carbon atoms and a double bond in the cis configuration (Z) between the ninth and tenth carbon atoms, as well as an oxo group at the first carbon atom. This structure gives the compound unique chemical properties and potential biological activities. It may have potential applications in the fields of biochemistry, pharmacology, and medical research.
Check Digit Verification of cas no
The CAS Registry Mumber 38665-30-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,8,6,6 and 5 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 38665-30:
(7*3)+(6*8)+(5*6)+(4*6)+(3*5)+(2*3)+(1*0)=144
144 % 10 = 4
So 38665-30-4 is a valid CAS Registry Number.
InChI:InChI=1/C23H43NO3S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22(25)24-21(23(26)27)19-20-28-2/h10-11,21H,3-9,12-20H2,1-2H3,(H,24,25)(H,26,27)/b11-10-/t21-/m0/s1