387-41-7 Usage
Uses
Used in Chemical Synthesis:
2,6-Dichlorobenzenediazonium tetrafluoroborate is used as a chemical intermediate for the synthesis of various organic compounds. Its reactivity allows it to participate in a wide range of reactions, making it a useful building block in the creation of complex organic molecules.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2,6-Dichlorobenzenediazonium tetrafluoroborate is used as a key intermediate in the synthesis of certain pharmaceutical compounds. Its unique structure and reactivity enable the development of new drugs with potential therapeutic applications.
Used in Dye and Pigment Industry:
2,6-Dichlorobenzenediazonium tetrafluoroborate is also utilized in the dye and pigment industry as a precursor for the production of various dyes and pigments. Its ability to form stable and vibrant colors makes it a valuable component in the formulation of high-quality dyes and pigments.
Used in Material Science:
In the field of material science, 2,6-Dichlorobenzenediazonium tetrafluoroborate is employed in the development of novel materials with specific properties. Its incorporation into polymers and other materials can lead to the creation of materials with improved characteristics, such as enhanced stability, conductivity, or other desirable properties.
Check Digit Verification of cas no
The CAS Registry Mumber 387-41-7 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 3,8 and 7 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 387-41:
(5*3)+(4*8)+(3*7)+(2*4)+(1*1)=77
77 % 10 = 7
So 387-41-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H3Cl2N2.BF4/c7-4-2-1-3-5(8)6(4)10-9;2-1(3,4)5/h1-3H;/q+1;-1
