38726-91-9 Usage
Diazo compound
Nitrogen-nitrogen double bond 2-((Diazoacetyl)amino)-N-ethylacetamide contains a diazo functional group, which is characterized by a nitrogen-nitrogen double bond (N≡N), giving it unique chemical properties.
Amide derivative
-NHCOfunctional group 2-((Diazoacetyl)amino)-N-ethylacetamide is an amide derivative because it contains an amide functional group (-NHCO-), which is a carbonyl group (C=O) bonded to a nitrogen atom.
Acetyl derivative
-COCH3 functional group 2-((Diazoacetyl)amino)-N-ethylacetamide is also an acetyl derivative, as it contains an acetyl functional group (-COCH3), which is a methyl group (CH3) bonded to a carbonyl group (C=O).
Unique chemical properties
Presence of functional groups The presence of diazo, amide, and acetyl functional groups in 2-((Diazoacetyl)amino)-N-ethylacetamide gives it unique chemical properties, making it a valuable compound in organic synthesis and medicinal chemistry.
Potential applications
Organic synthesis and medicinal chemistry Due to its unique chemical properties, 2-((Diazoacetyl)amino)-N-ethylacetamide has potential applications in the fields of organic synthesis and medicinal chemistry.
Safety precautions
Handle with care and follow safe laboratory practices Given its specific chemical structure, it is important to handle 2-((Diazoacetyl)amino)-N-ethylacetamide with care and follow appropriate safety measures in the laboratory to prevent any adverse reactions or hazards.
Check Digit Verification of cas no
The CAS Registry Mumber 38726-91-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,8,7,2 and 6 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 38726-91:
(7*3)+(6*8)+(5*7)+(4*2)+(3*6)+(2*9)+(1*1)=149
149 % 10 = 9
So 38726-91-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H10N4O2/c1-2-8-5(11)3-9-6(12)4-10-7/h4,9H,2-3H2,1H3,(H-,8,11,12)/b6-4-
