38727-09-2 Usage
Description
(+-)-2(a)-Amino-3(a)-phenyl-trans-decalin methanesulfonate is a chemical compound that features a decalin ring system with a trans-configuration and a phenyl group attached to one of the carbon atoms. It also includes an amino group and a methanesulfonate group, which contribute to its solubility in organic solvents and its utility in various applications.
Uses
Used in Organic Synthesis:
(+-)-2(a)-Amino-3(a)-phenyl-trans-decalin methanesulfonate is used as a chiral building block in organic synthesis for the preparation of pharmaceuticals and other biologically active molecules. Its asymmetric carbon in the decalin ring provides the compound with chirality, making it a valuable component in the synthesis of chiral compounds.
Used in Research:
In research settings, (+-)-2(a)-Amino-3(a)-phenyl-trans-decalin methanesulfonate serves as a versatile compound for studying the properties and reactions of chiral molecules. Its unique structure allows scientists to explore its potential applications in the development of new drugs and other advanced materials.
Used in Pharmaceutical Development:
(+-)-2(a)-Amino-3(a)-phenyl-trans-decalin methanesulfonate is utilized in the pharmaceutical industry as a key intermediate in the synthesis of various drugs. Its ability to enhance solubility and its chiral nature make it an essential component in the creation of new medications with improved efficacy and selectivity.
Used in the Synthesis of Biologically Active Molecules:
(+-)-2(a)-Amino-3(a)-phenyl-trans-decalin methanesulfonate is also employed in the synthesis of biologically active molecules, such as agrochemicals and other specialty chemicals. Its unique structure and properties enable the development of novel compounds with specific biological activities, contributing to advancements in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 38727-09-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,8,7,2 and 7 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 38727-09:
(7*3)+(6*8)+(5*7)+(4*2)+(3*7)+(2*0)+(1*9)=142
142 % 10 = 2
So 38727-09-2 is a valid CAS Registry Number.
InChI:InChI=1/C16H23N.CH4O3S/c17-16-11-14-9-5-4-8-13(14)10-15(16)12-6-2-1-3-7-12;1-5(2,3)4/h1-3,6-7,13-16H,4-5,8-11,17H2;1H3,(H,2,3,4)/t13-,14-,15+,16+;/m1./s1