387350-86-9 Usage
Uses
Used in Pharmaceutical Industry:
4-(4,6-Dimethoxypyrimidin-2-yl)aniline serves as an intermediate in the synthesis of pharmaceuticals, contributing to the development of new drugs. Its unique chemical structure allows it to be a key component in creating bioactive compounds with potential therapeutic applications.
Used in Agrochemical Industry:
Similarly, in the agrochemical sector, 4-(4,6-Dimethoxypyrimidin-2-yl)aniline is used as an intermediate in the synthesis of various agrochemicals. Its role in this industry is crucial for developing compounds that can be used in crop protection and other agricultural applications.
Used in Research and Chemical Synthesis:
4-(4,6-Dimethoxypyrimidin-2-yl)aniline is also widely used in research settings for its potential in the development of new chemical entities. It is a valuable tool for chemists and researchers working on the synthesis of complex organic molecules and exploring the compound's reactivity and properties in various chemical reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 387350-86-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,8,7,3,5 and 0 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 387350-86:
(8*3)+(7*8)+(6*7)+(5*3)+(4*5)+(3*0)+(2*8)+(1*6)=179
179 % 10 = 9
So 387350-86-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H13N3O2/c1-16-10-7-11(17-2)15-12(14-10)8-3-5-9(13)6-4-8/h3-7H,13H2,1-2H3
