38746-50-8

Usage

Uses

Used in Pharmaceutical Industry:
2-(4-Methylpyridin-2-yl)acetonitrile is used as an intermediate in the synthesis of various drugs and compounds. Its unique chemical structure allows it to be a key component in the development of new pharmaceuticals, contributing to the creation of innovative treatments and medications.
Used in Agrochemical Industry:
In the agrochemical sector, 2-(4-Methylpyridin-2-yl)acetonitrile serves as an essential intermediate for the production of various agrochemicals. Its role in this industry is crucial for the synthesis of compounds that can be used in pest control, crop protection, and other agricultural applications, thereby enhancing crop yields and ensuring food security.

InChI:InChI=1/C8H8N2/c1-7-3-5-10-8(6-7)2-4-9/h3,5-6H,2H2,1H3

Upstream product

• 1003-67-4 4-methylpyridine-1-oxide 
• 38198-16-2 4-methyl-pyridin-2-ylmethyl chloride 

Downstream Products

• 187592-35-4 2-(o-Chlorophenyl)-3-oxo-4-(4-methylpyridyl)-5-amino-2,3-dihydrofurane 

Relevant academic research and scientific papers

Novel flavors, flavor modifiers, tastants, taste enhancers, umami or sweet tastants, and/or enhancers and use thereof

The present invention relates to the discovery that certain non-naturally occurring, non-peptide amide compounds and amide derivatives, such as oxalamides, ureas, and acrylamides, are useful flavor or taste modifiers, such as a flavoring or flavoring agents and flavor or taste enhancer, more particularly, savory (the “umami” taste of monosodium glutamate) or sweet taste modifiers,—savory or sweet flavoring agents and savory or sweet flavor enhancers, for food, beverages, and other comestible or orally administered medicinal products or compositions.

3(2H)-furanone derivatives

The present invention relates to 3(2H)-furanone compounds possessing fungicidal activity to plant fungi and a process for preparing them.

Flash Vacuum Pyrolysis of Substituted Pyridine N-Oxides and Its Application to Syntheses of Heterocyclic Compounds

Flash vacuum pyrolysis of 2-picoline N-oxide gave 2-picoline, pyridine, 2-ethylpyridine, 2-vinylpyridine, 2-pyridylmethanol, bis(2-pyridyl)methane, 1,2-bis(2-pyridyl)ethane, and 1,2-bis(2-pyridyl)ethylene.These reactions are explained by intermediary participation of the 2-picolyl radical.Flash vacuum pyrolysis of methyl-substituted 2-benzylpyridine N-oxides led to methyl-substituted pyridoindoles or to benzoquinoline in moderate yields.