388088-73-1 Usage
General Description
(6-Morpholino-3-pyridinyl)methanol is a chemical compound with potential applications in the pharmaceutical and agricultural industries. It is a pyridine derivative that contains a morpholine ring, making it a valuable building block for the synthesis of various biologically active molecules. (6-MORPHOLINO-3-PYRIDINYL)METHANOL may be used as an intermediate for the production of pharmaceutical drugs, agrochemicals, or other specialty chemicals. Additionally, it has potential use in organic synthesis and research as a reagent or catalyst due to its unique structure and functional groups. Further studies and applications of (6-morpholino-3-pyridinyl)methanol are ongoing to fully explore its potential in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 388088-73-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,8,8,0,8 and 8 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 388088-73:
(8*3)+(7*8)+(6*8)+(5*0)+(4*8)+(3*8)+(2*7)+(1*3)=201
201 % 10 = 1
So 388088-73-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H14N2O2/c13-8-9-1-2-10(11-7-9)12-3-5-14-6-4-12/h1-2,7,13H,3-6,8H2
