38819-28-2 Usage
Description
(R)-2-amino-4-[(2-aminopropionyl)amino]-2,4-dideoxy-L-arabinose is a dideoxy sugar derivative of L-arabinose, characterized by the presence of two amino groups. This chemical compound holds potential in the pharmaceutical industry and serves as a building block for the synthesis of bioactive molecules. Its unique structure and properties contribute to its value in the development of new therapeutic agents and its study in antimicrobial agents and drug design.
Uses
Used in Pharmaceutical Industry:
(R)-2-amino-4-[(2-aminopropionyl)amino]-2,4-dideoxy-L-arabinose is used as a building block for the synthesis of bioactive molecules, contributing to the development of new therapeutic agents due to its unique structure and properties.
Used in Antimicrobial Research:
In the field of antimicrobial agents, (R)-2-amino-4-[(2-aminopropionyl)amino]-2,4-dideoxy-L-arabinose is used for studying its potential applications in creating new compounds with antimicrobial properties, which could be beneficial in the development of novel treatments for various infections.
Used in Drug Design:
(R)-2-amino-4-[(2-aminopropionyl)amino]-2,4-dideoxy-L-arabinose is utilized in drug design for its potential to enhance the properties of existing drugs or create new ones, thanks to its unique structural features and the possibility of incorporating it into various molecular frameworks.
Check Digit Verification of cas no
The CAS Registry Mumber 38819-28-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,8,8,1 and 9 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 38819-28:
(7*3)+(6*8)+(5*8)+(4*1)+(3*9)+(2*2)+(1*8)=152
152 % 10 = 2
So 38819-28-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H17N3O4/c1-3(9)7(13)11-4-2-15-8(14)5(10)6(4)12/h3-6,8,12,14H,2,9-10H2,1H3,(H,11,13)/t3-,4+,5-,6+,8+/m1/s1