38956-46-6 Usage
Uses
Used in Pharmaceutical Industry:
1H-IMIDAZO[4,5-B]PYRAZINE, 2-METHYLis used as a building block for the synthesis of various biologically active molecules, contributing to the development of new pharmaceutical compounds.
Used in Agrochemical Industry:
Similarly, in agrochemicals, 1H-IMIDAZO[4,5-B]PYRAZINE, 2-METHYLserves as a key component in the creation of molecules with pesticidal or herbicidal properties, enhancing crop protection strategies.
Used in Material Development:
1H-IMIDAZO[4,5-B]PYRAZINE, 2-METHYLis utilized in the research and development of new materials, potentially offering novel properties and applications in various industries.
Used in Organic Synthesis:
As an intermediate in organic synthesis, 1H-IMIDAZO[4,5-B]PYRAZINE, 2-METHYLplays a crucial role in the formation of complex organic molecules, facilitating advancements in chemical research and product development.
Check Digit Verification of cas no
The CAS Registry Mumber 38956-46-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,8,9,5 and 6 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 38956-46:
(7*3)+(6*8)+(5*9)+(4*5)+(3*6)+(2*4)+(1*6)=166
166 % 10 = 6
So 38956-46-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N4/c1-4-9-5-6(10-4)8-3-2-7-5/h2-3H,1H3,(H,7,8,9,10)
