38987-72-3 Usage
Uses
Used in Organic Synthesis:
2-Propanone, 1-bromo-3-hydroxyis used as a building block in organic synthesis for its ability to form various complex molecules. Its unique structure allows for the creation of a wide range of compounds, making it a valuable component in the synthesis process.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-Propanone, 1-bromo-3-hydroxyis used as an intermediate in the production of various drugs. Its versatility in forming different molecular structures makes it a crucial component in the development of new medications.
Used in Agrochemical Synthesis:
2-Propanone, 1-bromo-3-hydroxyis used as a key component in the synthesis of agrochemicals, such as pesticides and herbicides. Its role in creating complex molecules contributes to the development of effective agricultural products.
Used in Research and Development:
2-Propanone, 1-bromo-3-hydroxyis utilized in research and development settings to explore new chemical reactions and investigate its potential applications in various fields. Its unique properties make it an interesting subject for scientific study.
Check Digit Verification of cas no
The CAS Registry Mumber 38987-72-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,8,9,8 and 7 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 38987-72:
(7*3)+(6*8)+(5*9)+(4*8)+(3*7)+(2*7)+(1*2)=183
183 % 10 = 3
So 38987-72-3 is a valid CAS Registry Number.
InChI:InChI=1/C3H5BrO2/c4-1-3(6)2-5/h5H,1-2H2
