391248-14-9 Usage
Uses
Used in Pharmaceutical Research and Development:
4-(AMINOMETHYL)-1-N-FMOC-PIPERIDINE is utilized as a building block in the synthesis of pharmaceutical drugs and bioactive molecules. Its presence in the compound allows for the creation of diverse chemical structures that can be tailored for specific therapeutic applications.
Used in Organic Synthesis:
In the field of organic synthesis, 4-(AMINOMETHYL)-1-N-FMOC-PIPERIDINE is used as a protected amine precursor. The 1-N-Fmoc group ensures that the amine functional group remains intact and unreactive during intermediate steps of complex organic reactions, facilitating the synthesis of target molecules with greater precision and yield.
Used in Drug Design and Medicinal Chemistry:
4-(AMINOMETHYL)-1-N-FMOC-PIPERIDINE is employed as a key component in drug design, where its unique structure can be incorporated into potential drug candidates. Its versatility allows for the development of molecules with specific binding affinities and selectivity towards biological targets, contributing to the discovery of new therapeutic agents.
Used in Chemical Process Development:
In the chemical process development industry, 4-(AMINOMETHYL)-1-N-FMOC-PIPERIDINE is used to optimize the synthesis of complex organic compounds. Its protective group can be selectively removed when needed, enabling the controlled introduction of amine functional groups at specific stages of the synthesis process.
Overall, 4-(AMINOMETHYL)-1-N-FMOC-PIPERIDINE is a versatile and valuable compound in the fields of pharmaceutical research, organic synthesis, drug design, and chemical process development, playing a crucial role in the creation of new and effective chemical entities.
Check Digit Verification of cas no
The CAS Registry Mumber 391248-14-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,9,1,2,4 and 8 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 391248-14:
(8*3)+(7*9)+(6*1)+(5*2)+(4*4)+(3*8)+(2*1)+(1*4)=149
149 % 10 = 9
So 391248-14-9 is a valid CAS Registry Number.
InChI:InChI=1/C21H24N2O2.ClH/c22-13-15-9-11-23(12-10-15)21(24)25-14-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20;/h1-8,15,20H,9-14,22H2;1H