3914-45-2 Usage
Uses
Used in Organic Synthesis:
2-(CHLOROMETHYL)-5-ETHYL-1,3,4-OXADIAZOLE is used as a building block in organic synthesis for the creation of more complex molecules. Its chloromethyl and ethyl groups provide opportunities for further chemical reactions, making it a versatile component in the synthesis of various organic compounds.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 2-(CHLOROMETHYL)-5-ETHYL-1,3,4-OXADIAZOLE is used as a key intermediate in the development of new drugs. Its unique structure allows for the attachment of different functional groups, which can contribute to the pharmacological properties of the final drug molecule.
Used in Agrochemical Development:
2-(CHLOROMETHYL)-5-ETHYL-1,3,4-OXADIAZOLE may also be utilized in the development of new agrochemicals. Its reactivity and structural features can be leveraged to create compounds with specific pesticidal or herbicidal properties, contributing to the advancement of agricultural chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 3914-45-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,9,1 and 4 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 3914-45:
(6*3)+(5*9)+(4*1)+(3*4)+(2*4)+(1*5)=92
92 % 10 = 2
So 3914-45-2 is a valid CAS Registry Number.
InChI:InChI=1/C5H7ClN2O/c1-2-4-7-8-5(3-6)9-4/h2-3H2,1H3
