39145-52-3 Usage
Uses
Used in Pharmaceutical Industry:
AC-HIS-OH H2O is used as a pharmaceutical compound for its potential role in the synthesis of histidine N-acetyltransferase, which is encoded by the ectotherm homologue of human predicted gene NAT16. This enzyme is responsible for the synthesis of N-acetylhistidine, making it a crucial component in the development of new drugs and therapies.
Used in Research and Development:
AC-HIS-OH H2O is used as a research compound for studying the properties and potential applications of osmolytes in various biological systems. Its unique chemical properties and role in the lens of Atlantic salmon make it an interesting subject for further investigation and potential development of new technologies or treatments.
Used in Chemical Synthesis:
AC-HIS-OH H2O is used as a chemical intermediate in the synthesis of various compounds, taking advantage of its unique properties as a white crystalline powder. This allows for the creation of new materials and products with potential applications in various industries.
Purification Methods
Crystallise it from water, then 4:1 acetone/water. [Marshall et al. J Am Chem Soc 78 4636 1956, Bergmann & Zervas Biochem Z 203 280 1928, Greenstein & Winitz The Chemistry of the Amino Acids J. Wiley, Vol 3 p 1990 1961, Beilstein 25 IV 4359.]
Check Digit Verification of cas no
The CAS Registry Mumber 39145-52-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,9,1,4 and 5 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 39145-52:
(7*3)+(6*9)+(5*1)+(4*4)+(3*5)+(2*5)+(1*2)=123
123 % 10 = 3
So 39145-52-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H11N3O3.H2O/c1-5(12)11-7(8(13)14)2-6-3-9-4-10-6;/h3-4,7H,2H2,1H3,(H,9,10)(H,11,12)(H,13,14);1H2