39242-18-7 Usage
General Description
2,6-bis(1,2,4-triazol-1yl)pyridine is an organic chemical compound with the molecular formula C12H8N10. It is commonly used as a ligand in coordination chemistry and has a wide range of applications in catalysis, material science, and drug development. The compound is known for its ability to form stable complexes with various metal ions, making it a valuable component in the synthesis of coordination polymers and metal-organic frameworks. Its unique structure and electronic properties also make it a promising candidate for the development of new functional materials with potential applications in optoelectronics and molecular electronics. Additionally, 2,6-bis(1,2,4-triazol-1yl)pyridine has been studied for its potential biological activities, including antimicrobial and anticancer properties, highlighting its versatility and potential as a multifunctional chemical compound.
Check Digit Verification of cas no
The CAS Registry Mumber 39242-18-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,9,2,4 and 2 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 39242-18:
(7*3)+(6*9)+(5*2)+(4*4)+(3*2)+(2*1)+(1*8)=117
117 % 10 = 7
So 39242-18-7 is a valid CAS Registry Number.
InChI:InChI=1S/C9H7N7/c1-2-8(15-6-10-4-12-15)14-9(3-1)16-7-11-5-13-16/h1-7H
