39242-18-7 Usage
Uses
Used in Coordination Chemistry:
2,6-bis(1,2,4-triazol-1yl)pyridine is used as a ligand for forming stable complexes with metal ions, which is crucial in the synthesis of coordination polymers and metal-organic frameworks. Its role in this application is to provide structural stability and enhance the properties of the resulting compounds.
Used in Catalysis:
In the field of catalysis, 2,6-bis(1,2,4-triazol-1yl)pyridine is utilized as a catalyst or a catalyst support due to its ability to interact with reactants and facilitate chemical reactions more efficiently.
Used in Material Science:
2,6-bis(1,2,4-triazol-1yl)pyridine is employed in material science for the development of new functional materials. Its unique structure and electronic properties make it a promising candidate for applications in optoelectronics and molecular electronics, where materials with specific light absorption, emission, or charge transport properties are required.
Used in Drug Development:
2,6-bis(1,2,4-triazol-1yl)pyridine is used in drug development due to its potential biological activities, such as antimicrobial and anticancer properties. Its multifaceted nature allows it to be a versatile component in the creation of pharmaceuticals targeting various diseases.
Used in Antimicrobial Applications:
In the context of antimicrobial applications, 2,6-bis(1,2,4-triazol-1yl)pyridine is used for its potential to inhibit the growth of microorganisms, making it a candidate for use in treatments aimed at combating infections.
Used in Anticancer Applications:
2,6-bis(1,2,4-triazol-1yl)pyridine is also being studied for its potential as an anticancer agent, where it may be utilized to interfere with cancer cell growth and proliferation, offering a novel therapeutic approach to cancer treatment.
Check Digit Verification of cas no
The CAS Registry Mumber 39242-18-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,9,2,4 and 2 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 39242-18:
(7*3)+(6*9)+(5*2)+(4*4)+(3*2)+(2*1)+(1*8)=117
117 % 10 = 7
So 39242-18-7 is a valid CAS Registry Number.
InChI:InChI=1S/C9H7N7/c1-2-8(15-6-10-4-12-15)14-9(3-1)16-7-11-5-13-16/h1-7H
