39244-83-2 Usage
General Description
4-Amidinophenylacetic acid is a chemical compound that is also known as 4-APA and belongs to the class of amidine compounds. It consists of a phenylacetic acid molecule with an amidino group attached to its fourth carbon atom, and is commonly used in the pharmaceutical industry as a precursor for the synthesis of various drugs. 4-APA has been found to possess anti-inflammatory properties and has been investigated for its potential therapeutic uses in conditions such as septic shock, arthritis, and other inflammatory disorders. Additionally, it has also shown potential as an inhibitor of the enzyme dipeptidyl peptidase-4, which is involved in the regulation of blood sugar levels, making it a potential candidate for the treatment of diabetes.
Check Digit Verification of cas no
The CAS Registry Mumber 39244-83-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,9,2,4 and 4 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 39244-83:
(7*3)+(6*9)+(5*2)+(4*4)+(3*4)+(2*8)+(1*3)=132
132 % 10 = 2
So 39244-83-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H10N2O2/c10-9(11)7-3-1-6(2-4-7)5-8(12)13/h1-4H,5H2,(H3,10,11)(H,12,13)