393553-55-4 Usage
Uses
Used in Pharmaceutical Synthesis:
4-Bromo-6-methoxyindole is used as a building block for the synthesis of various pharmaceuticals due to its unique chemical structure and properties. Its presence in the molecular composition of drugs can contribute to their therapeutic effects and pharmacological profiles.
Used in Agrochemical Synthesis:
In the agrochemical industry, 4-Bromo-6-methoxyindole serves as a key intermediate in the production of various agrochemicals, including pesticides and herbicides. Its incorporation into these compounds can enhance their efficacy and selectivity in controlling pests and weeds.
Used in Organic Synthesis:
4-Bromo-6-methoxyindole is utilized as a versatile reagent in organic synthesis, where it can participate in a wide range of chemical reactions, such as coupling, substitution, and cyclization. Its reactivity and functional groups make it suitable for the preparation of complex organic molecules and advanced materials.
Used in Medicinal Chemistry Research:
4-Bromo-6-methoxyindole is employed as a valuable compound in medicinal chemistry research, where it is studied for its potential biological activities and pharmacological properties. Its exploration in this field can lead to the discovery of new drugs and therapeutic agents with improved efficacy and safety profiles.
Check Digit Verification of cas no
The CAS Registry Mumber 393553-55-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,9,3,5,5 and 3 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 393553-55:
(8*3)+(7*9)+(6*3)+(5*5)+(4*5)+(3*3)+(2*5)+(1*5)=174
174 % 10 = 4
So 393553-55-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H8BrNO/c1-12-6-4-8(10)7-2-3-11-9(7)5-6/h2-5,11H,1H3
393553-55-4Relevant academic research and scientific papers
3-Amino-1-arylpropyl indoles and aza-substituted indoles and uses thereof
-
Page/Page column 80, (2008/06/13)
The present invention provides compounds of the formula: or pharmaceutically acceptable salts, solvates or prodrugs thereof, wherein p, Ar, R1, R2, R3, Ra, Rb, Rc, Rd and Re are defined herein. Also provided are pharmaceutical compositions, methods of using, and methods of preparing the compounds.
