39409-82-0 Usage
Uses
Used in Pharmaceutical Industry:
Pentamagnesium dihydroxide carbonate tetrahydrate is used as a mineral supplement for its ability to provide the human body with essential magnesium, which plays a crucial role in various biological processes.
Used in Antacid Formulations:
Pentamagnesium dihydroxide carbonate tetrahydrate is utilized as an antacid due to its properties that help neutralize stomach acid, providing relief from symptoms associated with excess acidity.
Used in Ceramics Manufacturing:
Pentamagnesium dihydroxide carbonate tetrahydrate is employed in the production of ceramics, where it contributes to the desired physical and chemical properties of the final product.
Used as a Flame Retardant:
Pentamagnesium dihydroxide carbonate tetrahydrate is also used in flame retardant applications, where its chemical composition helps to slow down or prevent the spread of fire in various materials.
Check Digit Verification of cas no
The CAS Registry Mumber 39409-82-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,9,4,0 and 9 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 39409-82:
(7*3)+(6*9)+(5*4)+(4*0)+(3*9)+(2*8)+(1*2)=140
140 % 10 = 0
So 39409-82-0 is a valid CAS Registry Number.
InChI:InChI=1/CH2O3.2Mg.2H2O/c2-1(3)4;;;;/h(H2,2,3,4);;;2*1H2/q;2*+2;;/p-4