39512-80-6 Usage
Uses
Used in Pharmaceutical Industry:
1,2,4-Oxadiazole-3-carbothioamide is used as a pharmaceutical agent for its potential antimicrobial and anticancer activities. Its unique structure allows it to target specific biological pathways, making it a promising candidate for the development of new drugs to treat various diseases.
Used in Organic Synthesis:
1,2,4-Oxadiazole-3-carbothioamide is used as a building block in the synthesis of other organic compounds. Its versatile structure enables the creation of a wide range of molecules with different properties and applications, contributing to the advancement of organic chemistry.
Used in Materials Science:
1,2,4-Oxadiazole-3-carbothioamide is used in materials science for its potential applications in the development of new materials with unique properties. Its incorporation into various materials can lead to the creation of innovative products with improved performance and functionality.
Used in Medicinal Chemistry:
1,2,4-Oxadiazole-3-carbothioamide is used in medicinal chemistry for its potential to contribute to the discovery and development of new therapeutic agents. Its unique structure and pharmacological properties make it a valuable tool for researchers working on the design and synthesis of novel drugs.
Check Digit Verification of cas no
The CAS Registry Mumber 39512-80-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,9,5,1 and 2 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 39512-80:
(7*3)+(6*9)+(5*5)+(4*1)+(3*2)+(2*8)+(1*0)=126
126 % 10 = 6
So 39512-80-6 is a valid CAS Registry Number.
InChI:InChI=1/C3H3N3OS/c4-2(8)3-5-1-7-6-3/h1H,(H2,4,8)
39512-80-6Relevant academic research and scientific papers
REARRANGEMENTS OF 1-OXA-2-AZOLES. 8. SYNTHESIS AND REARRANGEMENT OF AMIDRAZONES OF 1,2,4-OXADIAZOLE-3-CARBOXYLIC ACID
Andrianov, V. G.,Semenikhina, V. G.,Eremeev, A. V.
, p. 803 - 807 (2007/10/02)
The possible isolation of amidrazones of 1,2,4-oxadiazole-3-carboxylic acid by three reaction schemes was studied.It was established that the given amidrazones are unstable and undergo rearrangement to derivatives of 4,5-diaminotriazole.
