39549-31-0 Usage
General Description
6-Amino-2,4-dichloro-3-methylphenol hydrochloride is a chemical compound used in the production of pharmaceutical products and as a laboratory reagent. It is an amino phenol derivative with two chloride groups and a methyl group attached to the benzene ring. It is commonly used as an intermediate in the synthesis of various organic compounds and pharmaceuticals. 6-Amino-2,4-dichloro-3-methylphenol hydrochloride is also known for its antimicrobial and antifungal properties, making it useful in the formulation of certain drugs and medical products. Additionally, it is often utilized as a reagent for the determination of various metal ions in analytical chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 39549-31-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,9,5,4 and 9 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 39549-31:
(7*3)+(6*9)+(5*5)+(4*4)+(3*9)+(2*3)+(1*1)=150
150 % 10 = 0
So 39549-31-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H7Cl2NO/c1-3-4(8)2-5(10)7(11)6(3)9/h2,11H,10H2,1H3
