3959-45-3 Usage
Explanation
The compound consists of 10 carbon atoms, 10 hydrogen atoms, 1 bromine atom, 3 nitrogen atoms, and 2 oxygen atoms in its structure.
2. Diazinane-2,4-dione derivative
Explanation
The compound is derived from the diazinane-2,4-dione structure, which is a core structure consisting of a 5-membered ring with two nitrogen atoms and two oxygen atoms.
3. Benzyl group attached
4. Bromine atom attached
Explanation
A bromine atom (Br) is attached to another nitrogen atom in the diazinane-2,4-dione core, which may influence the compound's reactivity, stability, and biological activity.
5. Potential applications in medicinal chemistry and drug development
Explanation
Due to its unique structure and potential biological activities, 1-benzyl-5-bromo-1,3-diazinane-2,4-dione may be used in the development of new drugs and therapeutic agents.
6. Building block for synthesis of other organic compounds
Explanation
The compound can be used as a starting material or intermediate for the synthesis of other organic compounds with similar chemical properties, expanding its potential applications in various fields.
7. Need for further research
Explanation
To fully understand the potential uses and properties of 1-benzyl-5-bromo-1,3-diazinane-2,4-dione, additional research is required, including studies on its reactivity, stability, and biological activity.
Check Digit Verification of cas no
The CAS Registry Mumber 3959-45-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,9,5 and 9 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 3959-45:
(6*3)+(5*9)+(4*5)+(3*9)+(2*4)+(1*5)=123
123 % 10 = 3
So 3959-45-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H11BrN2O2/c12-9-7-14(11(16)13-10(9)15)6-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,13,15,16)
3959-45-3Relevant academic research and scientific papers
DIHYDROURACIL COMPOUNDS AS ANTI-ICTOGENIC OR ANTI-EPILEPTOGENIC AGENTS
-
Page 34, (2010/11/30)
Methods and compounds useful for the inhibition of convulsive disorders, including epilepsy, are disclosed. The methods and compounds of the invention inhibit or prevent or treat ictogenesis, epileptogenesis, or epileptogenesis-associated conditions. Methods for preparing the compounds of the invention are also described. Particularly preferred compounds of the invention include Formula 1 as described herein.
