397843-70-8 Usage
General Description
3-(Butylaminocarbonyl)phenylboronic acid is a chemical compound with the molecular formula C12H18BNO3. It is classified as a boronic acid derivative and is used in organic synthesis and pharmaceutical research as a building block for the synthesis of various biologically active compounds. 3-(BUTYLAMINOCARBONYL)PHENYLBORONIC ACID is often utilized in the formation of carbon-carbon and carbon-heteroatom bonds through its boron moiety, making it a valuable tool in drug discovery and development. Its unique structure and reactivity make it a versatile reagent for the creation of new chemical entities with potential therapeutic applications. Additionally, its boronic acid functionality has been shown to exhibit potent inhibitory activity against certain enzymes and proteins, further expanding its potential in medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 397843-70-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,9,7,8,4 and 3 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 397843-70:
(8*3)+(7*9)+(6*7)+(5*8)+(4*4)+(3*3)+(2*7)+(1*0)=208
208 % 10 = 8
So 397843-70-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H16BNO3/c1-2-3-7-13-11(14)9-5-4-6-10(8-9)12(15)16/h4-6,8,15-16H,2-3,7H2,1H3,(H,13,14)
