39850-65-2 Usage
Uses
Used in Pharmaceutical Synthesis:
(3,3-dimethylbicyclo[2.2.1]hept-2-yl)acetic acid is used as a key intermediate in the synthesis of pharmaceuticals for its unique structural features and reactivity. Its incorporation into drug molecules can lead to the development of new medications with improved efficacy and selectivity.
Used in Organic Chemistry Research:
As a building block for the creation of complex organic compounds, (3,3-dimethylbicyclo[2.2.1]hept-2-yl)acetic acid is utilized in organic chemistry research to explore novel reactions and synthetic pathways. Its bicycloheptane core and carboxylic acid functionality provide a versatile platform for the construction of diverse organic molecules.
Used in Material Science:
(3,3-dimethylbicyclo[2.2.1]hept-2-yl)acetic acid may have potential applications in the development of new materials due to its structural properties. Its use in material science could lead to the creation of innovative materials with unique properties for various industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 39850-65-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,9,8,5 and 0 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 39850-65:
(7*3)+(6*9)+(5*8)+(4*5)+(3*0)+(2*6)+(1*5)=152
152 % 10 = 2
So 39850-65-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H18O2/c1-11(2)8-4-3-7(5-8)9(11)6-10(12)13/h7-9H,3-6H2,1-2H3,(H,12,13)
39850-65-2Relevant academic research and scientific papers
Ethylamine derivatives of cineole and norbornane
Mariani,Schenone
, p. 113 - 119 (2007/10/06)
Synthesis of 6 (2 aminoethyl) 1,3,3 trimethyl 2 oxabicyclo (2.2.2)octane (cineole 6 ethylamine) and 2 (2 aminoethyl) 3,3 dimethylbicyclo (2.2.1) heptane (3,3 dimethylnorbornane 2 ethylamine) and their unsaturated (2 aminoethylidene) analogs is described. 2 (2 Aminoethylidene) 3,3 dimethylbicyclo (2.2.1) heptane showed antiinflammatory and central stimulant activities in mouse; the cineole derivative, 6 (2 aminoethylidene) 1,3,3 trimethyl 2 oxabicyclo (2.2.2) octane, showed antiarrhythmic activity. 6 (Cyanomethylene) 1,3,3 trimethyl 2 oxabicyclo (2.2.2) octane, an intermediate to the synthesis of the cineole ethylamine derivatives, showed muscle relaxant activity.
