39891-06-0 Usage
Uses
Used in Pharmaceutical Industry:
2-(5-Fluoropyridin-3-yl)acetonitrile is used as a key building block for the synthesis of pharmaceuticals, contributing to the development of new drugs and therapeutic agents. Its unique chemical structure allows for the creation of diverse compounds with potential medicinal properties.
Used in Agrochemical Industry:
In the agrochemical industry, 2-(5-Fluoropyridin-3-yl)acetonitrile serves as a crucial component in the synthesis of various agrochemicals. Its incorporation into these compounds can enhance their effectiveness in agricultural applications, such as pest control and crop protection.
Used in Fine Chemicals Production:
2-(5-Fluoropyridin-3-yl)acetonitrile is utilized as an intermediate in the production of fine chemicals. Its presence in these compounds allows for the creation of high-quality specialty chemicals used in various industries, including cosmetics, fragrances, and flavorings.
Used in Medicinal Chemistry Research:
2-(5-Fluoropyridin-3-yl)acetonitrile has potential applications in the field of medicinal chemistry research. Its unique properties make it a valuable tool for the development of new drugs and therapeutic agents, as it can be modified and combined with other compounds to create novel pharmaceuticals with improved efficacy and safety profiles.
Check Digit Verification of cas no
The CAS Registry Mumber 39891-06-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,9,8,9 and 1 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 39891-06:
(7*3)+(6*9)+(5*8)+(4*9)+(3*1)+(2*0)+(1*6)=160
160 % 10 = 0
So 39891-06-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H5FN2/c8-7-3-6(1-2-9)4-10-5-7/h3-5H,1H2
