399-67-7 Usage
Uses
Used in Medicinal Chemistry:
7-Fluoro-1H-indole-2-carboxylic acid is used as a building block for the synthesis of new drugs, leveraging its unique chemical properties to create pharmaceutical compounds with potential therapeutic applications.
Used in Agrochemical Production:
7-FLUORO-1H-INDOLE-2-CARBOXYLIC ACID is utilized in the development of agrochemicals, where its chemical structure can contribute to the creation of effective products for agricultural use, such as pesticides or herbicides.
Used in Material Science:
7-Fluoro-1H-indole-2-carboxylic acid is employed in material science research, where its properties may be harnessed to develop new materials with specific characteristics for various applications.
Used in Chemical Research:
7-FLUORO-1H-INDOLE-2-CARBOXYLIC ACID serves as a subject of study in chemical research, where its properties and reactivity can be explored to advance understanding in organic chemistry and potentially lead to new discoveries or applications across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 399-67-7 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 3,9 and 9 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 399-67:
(5*3)+(4*9)+(3*9)+(2*6)+(1*7)=97
97 % 10 = 7
So 399-67-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H6FNO2/c10-6-3-1-2-5-4-7(9(12)13)11-8(5)6/h1-4,11H,(H,12,13)
