39969-29-4 Usage
Uses
Used in Organic Synthesis:
1-(2-(4-Ethoxyphenyl)ethynyl)-4-propylbenzene is used as a building block in organic synthesis for the creation of various pharmaceutical and agrochemical products. Its versatile structure allows for the development of new compounds with potential therapeutic and agricultural applications.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 1-(2-(4-Ethoxyphenyl)ethynyl)-4-propylbenzene is used as a key intermediate in the synthesis of drug molecules. Its unique structural features enable the design and development of novel therapeutic agents with improved efficacy and selectivity.
Used in Agrochemical Industry:
Similarly, in the agrochemical industry, 1-(2-(4-Ethoxyphenyl)ethynyl)-4-propylbenzene is employed as a precursor in the synthesis of agrochemicals, such as pesticides and herbicides. Its incorporation into these products can lead to enhanced performance and selectivity in controlling pests and weeds.
Used in Materials Science:
1-(2-(4-Ethoxyphenyl)ethynyl)-4-propylbenzene also has potential applications in materials science. Its structural properties can be exploited to develop new materials with unique properties, such as improved mechanical strength, thermal stability, or electrical conductivity.
Used in Polymer Chemistry:
In polymer chemistry, 1-(2-(4-Ethoxyphenyl)ethynyl)-4-propylbenzene can be used as a monomer or a comonomer in the synthesis of polymers with specific characteristics. Its incorporation into polymer chains can result in materials with tailored properties for various applications, such as high-performance plastics, adhesives, or coatings.
Check Digit Verification of cas no
The CAS Registry Mumber 39969-29-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,9,9,6 and 9 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 39969-29:
(7*3)+(6*9)+(5*9)+(4*6)+(3*9)+(2*2)+(1*9)=184
184 % 10 = 4
So 39969-29-4 is a valid CAS Registry Number.
InChI:InChI=1/C19H20O/c1-3-5-16-6-8-17(9-7-16)10-11-18-12-14-19(15-13-18)20-4-2/h6-9,12-15H,3-5H2,1-2H3
