39994-70-2 Usage
Uses
Used in Pharmaceutical Industry:
L-Threonine Ethyl Ester Hydrochloride is used as a pharmaceutical ingredient for its role in protein synthesis and maintaining proper protein balance in the body. Its enhanced solubility makes it a preferred choice in the development of medications that target various systems, such as the cardiovascular, liver, central nervous, and immune systems.
Used in Dietary Supplements:
L-Threonine Ethyl Ester Hydrochloride is used as a dietary supplement to provide the essential amino acid, L-Threonine, which is crucial for overall health and well-being. Its improved bioavailability ensures that the body can effectively utilize L-THREONINE ETHYL ESTER HYDROCHLORIDE for various physiological processes, including the synthesis of proteins and the maintenance of a healthy balance of proteins in the body.
Check Digit Verification of cas no
The CAS Registry Mumber 39994-70-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,9,9,9 and 4 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 39994-70:
(7*3)+(6*9)+(5*9)+(4*9)+(3*4)+(2*7)+(1*0)=182
182 % 10 = 2
So 39994-70-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H13NO3.ClH/c1-3-10-6(9)5(7)4(2)8;/h4-5,8H,3,7H2,1-2H3;1H/t4-,5+;/m1./s1
