400-05-5 Usage
General Description
1,4-Dichloro-2,5-difluorobenzene is a chemical compound with the molecular formula C6H2Cl2F2. It is a colorless liquid with a faint, sweet odor and is considered to be an aromatic compound. 1,4-Dichloro-2,5-difluorobenzene is primarily used as an intermediate in the production of agrochemicals, pharmaceuticals, and other specialty chemicals. It is also used as a solvent in various industrial processes. This chemical is considered to be harmful if swallowed, inhaled, or absorbed through the skin and should be handled and stored with proper precautions to minimize exposure and potential harm to human health and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 400-05-5 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 4,0 and 0 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 400-05:
(5*4)+(4*0)+(3*0)+(2*0)+(1*5)=25
25 % 10 = 5
So 400-05-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H2Cl2F2/c7-3-1-5(9)4(8)2-6(3)10/h1-2H
