40010-20-6 Usage
Uses
Used in Organic Synthesis:
4-FLUORO-4-DEOXY-D-GALACTOPYRANOSE is used as a key intermediate in the synthesis of various complex organic molecules, particularly in the pharmaceutical and chemical industries. Its unique chemical properties, such as the presence of a fluorine atom, make it a valuable building block for the development of novel compounds with potential applications in drug discovery and material science.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 4-FLUORO-4-DEOXY-D-GALACTOPYRANOSE is used as a starting material for the development of new drugs, especially those targeting carbohydrate-binding proteins. The fluorine atom in the molecule can enhance the bioactivity and pharmacokinetic properties of the resulting drug candidates, making them more effective and selective.
Used in Chemical Research:
4-FLUORO-4-DEOXY-D-GALACTOPYRANOSE is also utilized in academic and industrial research laboratories for studying the effects of fluorination on the reactivity and selectivity of carbohydrates. This knowledge can be applied to the design and synthesis of new carbohydrate-based compounds with potential applications in various fields, such as biochemistry, materials science, and nanotechnology.
Check Digit Verification of cas no
The CAS Registry Mumber 40010-20-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,0,1 and 0 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 40010-20:
(7*4)+(6*0)+(5*0)+(4*1)+(3*0)+(2*2)+(1*0)=36
36 % 10 = 6
So 40010-20-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H11FO5/c7-3-2(1-8)12-6(11)5(10)4(3)9/h2-6,8-11H,1H2/t2-,3+,4+,5-,6?/m1/s1
