40019-65-6 Usage
Uses
Used in Pharmaceutical Synthesis:
1H-Benzimidazole-1-ethanol,2-chloro-(9CI) is used as a key intermediate in the synthesis of pharmaceuticals for its ability to be incorporated into the molecular structures of various biologically active molecules. The presence of the benzimidazole and chloro groups in its structure allows for the development of compounds with potential therapeutic applications, such as antimicrobial, antifungal, and anticancer agents.
Used in Agrochemical Production:
In the agrochemical industry, 1H-Benzimidazole-1-ethanol,2-chloro-(9CI) serves as a building block for the creation of agrochemicals. Its chemical properties make it suitable for the development of pesticides and other agricultural chemicals that can help protect crops from pests and diseases, thereby increasing agricultural productivity.
Used in Dye Manufacturing:
1H-Benzimidazole-1-ethanol,2-chloro-(9CI) is also utilized in the production of dyes due to its chemical structure that can contribute to the color properties of various dyes. This application is particularly relevant in the textile, paint, and printing industries, where dyes are essential for coloring fabrics, surfaces, and printed materials.
Used in Specialty Chemicals:
1H-Benzimidazole-1-ethanol,2-chloro-(9CI) finds use in the production of specialty chemicals, where its unique structure and properties can be leveraged to create compounds with specific functions. These specialty chemicals can be employed in various industries, such as cosmetics, coatings, and materials science, to impart desired characteristics to the final products.
Check Digit Verification of cas no
The CAS Registry Mumber 40019-65-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,0,1 and 9 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 40019-65:
(7*4)+(6*0)+(5*0)+(4*1)+(3*9)+(2*6)+(1*5)=76
76 % 10 = 6
So 40019-65-6 is a valid CAS Registry Number.
InChI:InChI=1/C9H9ClN2O/c10-9-11-7-3-1-2-4-8(7)12(9)5-6-13/h1-4,13H,5-6H2
40019-65-6Relevant academic research and scientific papers
Derivatives of 2H,3H-benzimidazo(1,2-b)oxazole
-
, (2008/06/13)
Derivatives of 2H, 3H-benzimidazo (1,2-b) oxazole have the property of inhibiting the beta-lactamase produced by many germs resistant to penicillins and cephalosporins, and may be used in mixture with these antibiotics to increase their activity.
