40023-03-8 Usage
Uses
Given the provided materials, there are no explicit uses listed for N-(1,3-Benzodioxol-5-ylmethyl)-2-chloroacetamide. However, based on its potential biological activity and structural features, we can hypothesize several possible applications in different industries:
Used in Pharmaceutical Research:
N-(1,3-Benzodioxol-5-ylmethyl)-2-chloroacetamide could be used as a research compound for exploring its biological activity and potential therapeutic effects. The presence of the benzodioxole moiety and chloroacetamide group may allow it to interact with specific biological targets, such as enzymes or receptors, which could lead to the development of new drugs.
Used in Drug Development:
In the pharmaceutical industry, N-(1,3-Benzodioxol-5-ylmethyl)-2-chloroacetamide might be employed as a lead compound in the design and synthesis of new drugs. Its unique structural features could be further optimized to enhance its pharmacological properties, such as potency, selectivity, and bioavailability.
Used in Chemical Synthesis:
N-(1,3-Benzodioxol-5-ylmethyl)-2-chloroacetamide could also be utilized as a synthetic intermediate or building block in the preparation of other complex organic molecules. Its benzodioxole and chloroacetamide functionalities may be valuable in the synthesis of various chemical compounds, including pharmaceuticals, agrochemicals, or specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 40023-03-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,0,2 and 3 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 40023-03:
(7*4)+(6*0)+(5*0)+(4*2)+(3*3)+(2*0)+(1*3)=48
48 % 10 = 8
So 40023-03-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H10ClNO3/c11-4-10(13)12-5-7-1-2-8-9(3-7)15-6-14-8/h1-3H,4-6H2,(H,12,13)
