40107-16-2 Usage
Uses
Used in Pharmaceutical Research:
4-Amino-7-iodoquinoline is used as a key intermediate in the synthesis of new drugs and medications, particularly for its potential antimalarial and antibacterial properties. Its unique chemical structure allows for the development of novel therapeutic agents that can target specific diseases.
Used in Antimalarial Applications:
4-Amino-7-iodoquinoline is used as an antimalarial agent, as it has been studied for its ability to combat malaria-causing parasites. Its potential to inhibit the growth and reproduction of these parasites makes it a valuable compound in the search for new antimalarial treatments.
Used in Antibacterial Applications:
4-AMINO-7-IODOQUINOLINE is also used as an antibacterial agent, given its potential to inhibit the growth of various types of bacteria. Its ability to target and disrupt bacterial cell functions can contribute to the development of new antibiotics to combat drug-resistant bacterial strains.
Used in Photodynamic Therapy:
4-Amino-7-iodoquinoline is used in photodynamic therapy for cancer treatment. Its ability to absorb light and generate reactive oxygen species upon illumination makes it a promising candidate for the targeted destruction of cancer cells while minimizing damage to surrounding healthy tissue.
Used in Fluorescence Imaging and Analytical Chemistry:
Due to its fluorescence properties, 4-amino-7-iodoquinoline is used in fluorescence imaging and analytical chemistry applications. Its ability to emit light upon excitation allows for its use in various detection and imaging techniques, enhancing the study and analysis of biological and chemical processes.
Used in Organic Synthesis:
4-Amino-7-iodoquinoline is used as a building block in organic synthesis, enabling the creation of a wide range of chemical compounds with diverse applications. Its versatile structure allows for the development of new materials and compounds for various industries.
Safety Precautions:
It is important to handle 4-amino-7-iodoquinoline with caution, as it may be harmful if ingested or inhaled and can cause skin and eye irritation. Proper safety measures, such as wearing protective gear and working in a well-ventilated area, should be taken to minimize potential health risks.
Check Digit Verification of cas no
The CAS Registry Mumber 40107-16-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,1,0 and 7 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 40107-16:
(7*4)+(6*0)+(5*1)+(4*0)+(3*7)+(2*1)+(1*6)=62
62 % 10 = 2
So 40107-16-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H7IN2/c10-6-1-2-7-8(11)3-4-12-9(7)5-6/h1-5H,(H2,11,12)
