40107-94-6 Usage
Uses
Used in Pharmaceutical Industry:
5H-Pyrrolo[3,4-b]pyridin-5-one, 6,7-dihydro-6-methylis used as a building block in the synthesis of pharmaceuticals for its unique structure and properties. It contributes to the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, 5H-Pyrrolo[3,4-b]pyridin-5-one, 6,7-dihydro-6-methylserves as a key component in the creation of agrochemicals, such as pesticides and herbicides, due to its chemical properties that can be harnessed for controlling pests and weeds.
Used in Therapeutic Applications:
5H-Pyrrolo[3,4-b]pyridin-5-one, 6,7-dihydro-6-methylis studied for its potential therapeutic uses in treating various diseases. Its unique structure allows it to interact with biological targets, offering new avenues for drug discovery and development.
Used in Other Industrial Applications:
Due to its distinctive structure and properties, 5H-Pyrrolo[3,4-b]pyridin-5-one, 6,7-dihydro-6-methylmay also find uses in other industries where its chemical characteristics can be applied for specific purposes, such as in the development of new materials or chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 40107-94-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,1,0 and 7 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 40107-94:
(7*4)+(6*0)+(5*1)+(4*0)+(3*7)+(2*9)+(1*4)=76
76 % 10 = 6
So 40107-94-6 is a valid CAS Registry Number.
InChI:InChI=1S/C8H8N2O/c1-10-5-7-6(8(10)11)3-2-4-9-7/h2-4H,5H2,1H3