40113-03-9

Usage

Uses

Used in Pharmaceutical Synthesis:
1-Cbz-Piperidin-4-ylidene-acetic acid is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to modify and enhance the properties of bioactive compounds. The presence of the Cbz protecting group allows for selective reactions to occur, facilitating the creation of complex molecular structures with improved pharmacological profiles.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 1-Cbz-Piperidin-4-ylidene-acetic acid is utilized as a versatile building block for the development of new drugs. Its unique reactivity and the presence of the piperidine ring make it suitable for the construction of molecules with potential therapeutic applications, contributing to the advancement of novel treatment options for various diseases.
Used in Organic Synthesis:
1-Cbz-Piperidin-4-ylidene-acetic acid is employed as a reactant in organic synthesis, where the Cbz protecting group plays a crucial role in controlling the reactivity of the molecule. This allows chemists to carry out specific reactions without affecting the amino group, leading to the formation of a diverse range of organic compounds with potential applications in various industries.
Overall, 1-Cbz-Piperidin-4-ylidene-acetic acid's multifaceted applications across different industries highlight its significance as a chemical compound with broad implications in the development of new pharmaceuticals, organic compounds, and therapeutic agents.

InChI:InChI=1/C15H17NO4/c17-14(18)10-12-6-8-16(9-7-12)15(19)20-11-13-4-2-1-3-5-13/h1-5,10H,6-9,11H2,(H,17,18)

Upstream product

• 193022-93-4 4-tert-butoxycarbonyl-methylene-N-CBZ-piperidine 

Relevant academic research and scientific papers

Matrix metalloprotease inhibitors

The present invention relates to compounds of Formula I: STR1 that are matrix metalloprotease inhibitors, pharmaceutical compositions containing them, methods for their use and methods of preparing these compounds.

Matrix metalloprotease inhibitors

Compounds of the formula: wherein: n is0, 1 or 2; Y ishydroxy or XONH-, where X is hydrogen or lower alkyl; R1is hydrogen or lower alkyl; R2is hydrogen, lower alkyl, heteroalkyl, aryl, aralkyl, arylheteroalkyl, cycloalkyl, cycloalkylalkyl, heteroaryl, heteroaralkyl, heteroarylheteroalkyl, heterocyclo, heterocylo-lower alkyl, heterocyclo-lower heteroalkyl or -NR6R7, wherein: R6is hydrogen, lower alkyl, cycloalkyl or cycloalkylalkyl, aryl, heteroaryl and heteroaralkyl; R7is hydrogen, lower alkyl, cycloalkyl or cycloalkylalkyl, aryl, aralkyl, heteroaryl, heteroaralkyl, -C(O)R8, -C(O)NR8R9, -SO2NR8R9, -SO2R10, aryloxycarbonyl, or alkoxycarbonyl; or R6and R7together with the nitrogen atom to which they are attached represent a heterocyclo group; wherein R8and R9are independently hydrogen, lower alkyl, cycloalkyl, cycloalkylalkyl, aryl, aralkyl, heteroaryl, heteroaralkyl or heteroalkyl; and R10is lower alkyl, cycloalkyl, cycloalkylalkyl, aryl, aralkyl, heteroaryl, heteroaralkyl, heteroalkyl or heterocyclo; or R1and R2together with the carbon atom to which they are attached represent a cycloalkyl or heterocyclo group; R3ishydrogen, lower alkyl, cycloalkyl, cycloalkylalkyl, aryl, aralkyl, heteroaryl, heteroaralkyl, heteroalkyl or lower alkoxy; R4ishydrogen, lower alkyl, cycloalkyl or cycloalkylalkyl; or R2and R3together with the carbons to which they are attached represent a cycloalkyl or heterocyclo group; or R3and R4together with the carbon to which they are attached represent a cycloalkyl or heterocyclo group; and R5islower alkyl, cycloalkyl, cycloalkylalkyl, aryl, aralkyl, heteroaryl, or heteroaralkyl; or pharmaceutically acceptable salts or esters thereof exhibit useful pharmacological properties, in particular for use as matrix metalloprotease inhibitors, particularly for interstitial collagenases.