40133-08-2 Usage
Uses
Used in Organic Synthesis:
5,6,7,8-TETRAHYDRO-4H-CYCLOHEPTA[B]THIOPHENE-2-CARBOXYLIC ACID is used as a building block in organic synthesis for its unique structural features and reactivity. Its cyclic structure and the presence of a sulfur atom and carboxylic acid group make it a valuable intermediate in the production of various chemical compounds.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 5,6,7,8-TETRAHYDRO-4H-CYCLOHEPTA[B]THIOPHENE-2-CARBOXYLIC ACID is utilized as a key component in the development of new drug molecules. Its potential biological activities and pharmacological properties contribute to the discovery and synthesis of novel therapeutic agents.
Used in Drug Synthesis:
5,6,7,8-TETRAHYDRO-4H-CYCLOHEPTA[B]THIOPHENE-2-CARBOXYLIC ACID serves as a crucial intermediate in the synthesis of diverse drug molecules. Its unique structural features and reactivity enable the development of innovative pharmaceutical compounds with potential therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 40133-08-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,1,3 and 3 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 40133-08:
(7*4)+(6*0)+(5*1)+(4*3)+(3*3)+(2*0)+(1*8)=62
62 % 10 = 2
So 40133-08-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H12O2S/c11-10(12)9-6-7-4-2-1-3-5-8(7)13-9/h6H,1-5H2,(H,11,12)