401567-96-2 Usage
Uses
Used in Pharmaceutical Industry:
Isoquinoline,4-bromo-1-(1-piperazinyl)is used as a pharmaceutical compound for its potential therapeutic applications. Its unique structure, which includes a piperazine ring and a bromine atom, may contribute to its interaction with biological targets, making it a candidate for the development of new drugs.
Used in Chemical Research:
In the field of chemical research, Isoquinoline,4-bromo-1-(1-piperazinyl)serves as a subject of study for understanding the properties and reactivity of isoquinoline derivatives. Its synthesis and modification can provide insights into the development of new chemical entities with potential applications in various industries.
Used in Material Science:
Isoquinoline,4-bromo-1-(1-piperazinyl)may also find applications in material science, particularly in the development of new materials with specific properties. The presence of the piperazine ring and bromine atom could influence the compound's electronic, optical, or structural characteristics, making it a candidate for use in advanced materials.
Check Digit Verification of cas no
The CAS Registry Mumber 401567-96-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,0,1,5,6 and 7 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 401567-96:
(8*4)+(7*0)+(6*1)+(5*5)+(4*6)+(3*7)+(2*9)+(1*6)=132
132 % 10 = 2
So 401567-96-2 is a valid CAS Registry Number.
InChI:InChI=1/C13H14BrN3/c14-12-9-16-13(17-7-5-15-6-8-17)11-4-2-1-3-10(11)12/h1-4,9,15H,5-8H2
