401629-04-7 Usage
Uses
Used in Organic Chemical Synthesis:
3-Cyclopropylpyrazole-5-carboxylic acid is used as an intermediate in the synthesis of various organic compounds. Its unique structure allows for further functionalization and modification, making it a valuable building block for the development of new molecules with specific properties and applications.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3-cyclopropylpyrazole-5-carboxylic acid is used as a key intermediate for the synthesis of various drug candidates. Its structural diversity and potential for further modification make it an attractive starting point for the development of new therapeutic agents, particularly in the areas of anti-inflammatory, analgesic, and anti-cancer drugs.
Used in Agrochemical Industry:
3-Cyclopropylpyrazole-5-carboxylic acid also finds application in the agrochemical industry, where it is used as a precursor for the synthesis of various agrochemicals, such as pesticides and herbicides. Its unique structural features enable the development of novel compounds with improved efficacy and selectivity, contributing to more effective and environmentally friendly agricultural practices.
Check Digit Verification of cas no
The CAS Registry Mumber 401629-04-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,0,1,6,2 and 9 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 401629-04:
(8*4)+(7*0)+(6*1)+(5*6)+(4*2)+(3*9)+(2*0)+(1*4)=107
107 % 10 = 7
So 401629-04-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N2O2/c10-7(11)6-3-5(8-9-6)4-1-2-4/h3-4H,1-2H2,(H,8,9)(H,10,11)
