40180-03-8 Usage
Uses
Used in Organic Synthesis:
2,3-Dichloro-4-hydroxyphenyl 2-thienyl ketone is used as an intermediate in the synthesis of various organic compounds. Its unique structure allows it to be a valuable building block for creating a wide range of molecules with different functionalities and applications.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2,3-Dichloro-4-hydroxyphenyl 2-thienyl ketone is used as a key component in the development of new drugs. Its chemical properties make it suitable for the synthesis of bioactive molecules with potential therapeutic applications.
Used in Chemical Research:
2,3-Dichloro-4-hydroxyphenyl 2-thienyl ketone is also utilized in chemical research for studying reaction mechanisms, exploring new synthetic routes, and understanding the relationship between chemical structure and biological activity.
Used in Material Science:
2,3-Dichloro-4-hydroxyphenyl 2-thienyl ketone may find applications in material science, where its unique properties can be exploited to develop new materials with specific characteristics, such as improved stability, reactivity, or selectivity in various chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 40180-03-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,1,8 and 0 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 40180-03:
(7*4)+(6*0)+(5*1)+(4*8)+(3*0)+(2*0)+(1*3)=68
68 % 10 = 8
So 40180-03-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H6Cl2O2S/c12-9-6(3-4-7(14)10(9)13)11(15)8-2-1-5-16-8/h1-5,14H
40180-03-8Relevant academic research and scientific papers
2,3-Dichloro-4-hydroxy-benzoic acid and process for preparation thereof
-
, (2008/06/13)
A Reimer-Tiemann reaction of 2,3-dichlorophenol with carbon tetrachloride gives 2,3-dichloro-4-hydroxy-benzoic acid, a novel intermediate, which is then reacted with thiophene in the presence of phosphorus pentoxide or polyphosphoric acid to give 2,3-dichloro-4-(2-thienoyl)-phenol. This compound is then converted to the diuretic, ticrynafen, by known prior art reactions.
