401936-07-0 Usage
Uses
Used in Dye Production:
Benzothiazole, 2,4,5-trimethyl(9CI) is used as a key intermediate in the synthesis of dyes, contributing to the development of colorants with specific properties for various applications.
Used in Pharmaceutical Industry:
In the pharmaceutical sector, Benzothiazole, 2,4,5-trimethyl(9CI) is utilized as a crucial component in the production of various drugs, owing to its unique chemical structure that can be modified to achieve desired therapeutic effects.
Used in Rubber Chemicals:
Benzothiazole, 2,4,5-trimethyl(9CI) is employed as a vital ingredient in the formulation of rubber chemicals, enhancing the performance and durability of rubber products.
Used in Pesticide, Insecticide, and Herbicide Synthesis:
Benzothiazole, 2,4,5-trimethyl(9CI) also serves as an intermediate in the synthesis of agricultural chemicals, including pesticides, insecticides, and herbicides, where it contributes to the development of effective and targeted formulations for pest and weed control.
Environmental Considerations:
Given its widespread use, Benzothiazole, 2,4,5-trimethyl(9CI) is considered a potential environmental contaminant. It may pose risks to human health and the environment if not managed properly. Therefore, strict adherence to safety regulations and guidelines is essential for its handling and disposal to minimize any adverse impacts.
Check Digit Verification of cas no
The CAS Registry Mumber 401936-07-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,0,1,9,3 and 6 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 401936-07:
(8*4)+(7*0)+(6*1)+(5*9)+(4*3)+(3*6)+(2*0)+(1*7)=120
120 % 10 = 0
So 401936-07-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H11NS/c1-6-4-5-9-10(7(6)2)11-8(3)12-9/h4-5H,1-3H3
