40207-09-8 Usage
Uses
Used in Chemical and Biological Processes:
(3,5-Bis-carboxymethyl-2,4,6-trimethyl-phenyl)-acetic acid is used as a chelating agent for its ability to bind to metal ions and form stable complexes, which is crucial in various chemical and biological processes.
Used in Pharmaceutical Industry:
(3,5-Bis-carboxymethyl-2,4,6-trimethyl-phenyl)-acetic acid is used as a potential therapeutic agent due to its studied anti-inflammatory and antioxidant properties, indicating its potential in the development of pharmaceuticals for treating various conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 40207-09-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,2,0 and 7 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 40207-09:
(7*4)+(6*0)+(5*2)+(4*0)+(3*7)+(2*0)+(1*9)=68
68 % 10 = 8
So 40207-09-8 is a valid CAS Registry Number.
InChI:InChI=1/C15H18O6/c1-7-10(4-13(16)17)8(2)12(6-15(20)21)9(3)11(7)5-14(18)19/h4-6H2,1-3H3,(H,16,17)(H,18,19)(H,20,21)
40207-09-8Relevant academic research and scientific papers
Topological correspondence between crystal structure of 2,4,6-trimethylbenzene-1,3,5-tris(methanaminium) 2,4,6-trimethylbenzene-1,3,5-triacetate and cesium chloride
Podlaha, Jaroslav,Cisarova, Ivana,Alexander, Daniel,Holy, Petr,Kraus, Tomas,Zavada, Jiri
, p. 1587 - 1596 (2007/10/03)
Solid-state self-assembly of 2,4,6-trimethylbenzene-1,3,5-tris(methanaminium) 2,4,6-trimethylbenzene-1,3,5-triacetate is mediated by hydrogen bonding. It gives rise to three-dimensional network of hydrogen bonds in which each trication is coordinated with
